churchillvanessam churchillvanessam

03-10-2020
Chemistry

contestada

For NH4NO3(s) write a balanced thermochemical equation.

Respuesta :

sagarsaud666 sagarsaud666

03-10-2020

Answer:

step1

NH4NO3(s)+H2O(I)--------->NH⁴OH(aq)+HNO³(aq)

step²

NH⁴OH(aq)+HNO³(aq)-------->NH⁴+(aq)+NO³-(aq)+H²O(I)

Answer Link

Otras preguntas

An iron fence is left unpainted, and it reacts with the oxygen in the air, forming rust. The formation of rust is an oxidation-reduction reaction, but it is als

What is the value of c in the equation below?A: -4B: -2C: 1/64 (fraction)D: 1/4 (fraction)

Miguel borrowed $1,800for 2 years and ended up paying $180 in simple interest . What was the interest rate

The mean of a population being sampled is 64, and the standard deviation is 6. If the sample size is 50, the standard error of the mean is ___. (Round off your

Match each example to its type of energy. solar energy nuclear energy fossil fuel energy wind energy geothermal energy A. energy obtained from a renewable sour

Rob walked 2/10 block. Drew walked 5/10 block. Write a comparison for the distance Rob and Drew each walked.

HELLOOOOOOOOOOOO CAN U WRITE THIS IN YOUR OWN WORDS: A hero is a person who is known for certain achievements and qualities.

Juan is studying fossils. His teacher wrote the following statements on the board and asked the students to put them in the correct order to describe how fossil

Solve for y, then graph the equation, 10x-3y=15

Match each health screening to the correct disease. A. Blood cell count 1 COPD B. X-ray 2 Iron deficiency C. BMI 3 Obesity